C17H29N — CID 173178536
2-nonan-2-yl-4,5,6,7-tetrahydro-1H-indole (PubChem CID 173178536) has the molecular formula C17H29N and a molecular weight of 247.43 g/mol. Its IUPAC name is 2-nonan-2-yl-4,5,6,7-tetrahydro-1H-indole.
| Compound Name | 2-nonan-2-yl-4,5,6,7-tetrahydro-1H-indole |
|---|---|
| PubChem CID | 173178536 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | 2-nonan-2-yl-4,5,6,7-tetrahydro-1H-indole |
| SMILES | CCCCCCCC(C)c1cc2c([nH]1)CCCC2 |
| InChI | InChI=1S/C17H29N/c1-3-4-5-6-7-10-14(2)17-13-15-11-8-9-12-16(15)18-17/h13-14,18H,3-12H2,1-2H3 |
| InChIKey | IFTKDTUDEWMQAS-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|