C18H34N2 — CID 167073389
1-(2,3-dimethylbut-3-enyl)-4-(2-methyl-3-methylidenehexyl)piperazine (PubChem CID 167073389) has the molecular formula C18H34N2 and a molecular weight of 278.48 g/mol. Its IUPAC name is 1-(2,3-dimethylbut-3-enyl)-4-(2-methyl-3-methylidenehexyl)piperazine.
| Compound Name | 1-(2,3-dimethylbut-3-enyl)-4-(2-methyl-3-methylidenehexyl)piperazine |
|---|---|
| PubChem CID | 167073389 |
| Molecular Formula | C18H34N2 |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.27 |
| IUPAC Name | 1-(2,3-dimethylbut-3-enyl)-4-(2-methyl-3-methylidenehexyl)piperazine |
| SMILES | C=C(C)C(C)CN1CCN(CC(C)C(=C)CCC)CC1 |
| InChI | InChI=1S/C18H34N2/c1-7-8-16(4)18(6)14-20-11-9-19(10-12-20)13-17(5)15(2)3/h17-18H,2,4,7-14H2,1,3,5-6H3 |
| InChIKey | VWKAFRWBLYHJNF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|