C24H30N11O10P — CID 167078581
[(1R,2R,3S,4R)-4-(2-amino-6-oxo-1H-purin-9-yl)-2,3-dihydroxycyclopentyl]methyl [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] 2-cyanoethyl phosphate (PubChem CID 167078581) has the molecular formula C24H30N11O10P and a molecular weight of 663.54 g/mol. Its IUPAC name is [(1R,2R,3S,4R)-4-(2-amino-6-oxo-1H-purin-9-yl)-2,3-dihydroxycyclopentyl]methyl [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] 2-cyanoethyl phosphate.
| Compound Name | [(1R,2R,3S,4R)-4-(2-amino-6-oxo-1H-purin-9-yl)-2,3-dihydroxycyclopentyl]methyl [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] 2-cyanoethyl phosphate |
|---|---|
| PubChem CID | 167078581 |
| Molecular Formula | C24H30N11O10P |
| Molecular Weight | 663.54 g/mol |
| Exact Mass | 663.19 |
| IUPAC Name | [(1R,2R,3S,4R)-4-(2-amino-6-oxo-1H-purin-9-yl)-2,3-dihydroxycyclopentyl]methyl [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] 2-cyanoethyl phosphate |
| SMILES | N#CCCOP(=O)(OC[C@H]1C[C@@H](n2cnc3c(=O)[nH]c(N)nc32)[C@H](O)[C@@H]1O)O[C@H]1[C@@H](O)[C@H](n2cnc3c(N)ncnc32)O[C@@H]1CO |
| InChI | InChI=1S/C24H30N11O10P/c25-2-1-3-42-46(41,45-18-12(5-36)44-23(17(18)39)35-9-30-13-19(26)28-7-29-20(13)35)43-6-10-4-11(16(38)15(10)37)34-8-31-14-21(34)32-24(27)33-22(14)40/h7-12,15-18,23,36-39H,1,3-6H2,(H2,26,28,29)(H3,27,32,33,40)/t10-,11-,12-,15-,16+,17-,18-,23-,46?/m1/s1 |
| InChIKey | PKPIGJWVJLXFQJ-BOECKVILSA-N |
| XLogP | -1.90 |
| TPSA | 317.91 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.54 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|