About [chloro-(2-methylbenzoyl)oxy-diphenyl-λ5-stibanyl] 2-methylbenzoate
[chloro-(2-methylbenzoyl)oxy-diphenyl-λ5-stibanyl] 2-methylbenzoate (PubChem CID 16707993) has the molecular formula C28H24ClO4Sb
and a molecular weight of 581.71 g/mol. Its IUPAC name is [chloro-(2-methylbenzoyl)oxy-diphenyl-λ5-stibanyl] 2-methylbenzoate.
Molecular Properties
| Compound Name | [chloro-(2-methylbenzoyl)oxy-diphenyl-λ5-stibanyl] 2-methylbenzoate |
| PubChem CID | 16707993 |
| Molecular Formula | C28H24ClO4Sb |
| Molecular Weight | 581.71 g/mol |
| Exact Mass | 580.04 |
| IUPAC Name | [chloro-(2-methylbenzoyl)oxy-diphenyl-λ5-stibanyl] 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)O[Sb](Cl)(OC(=O)c1ccccc1C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/2C8H8O2.2C6H5.ClH.Sb/c2*1-6-4-2-3-5-7(6)8(9)10;2*1-2-4-6-5-3-1;;/h2*2-5H,1H3,(H,9,10);2*1-5H;1H;/q;;;;;+3/p-3 |
| InChIKey | IMFKJBCDYSTHNJ-UHFFFAOYSA-K |
| XLogP | 5.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 581.71 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [chloro-(2-methylbenzoyl)oxy-diphenyl-λ5-stibanyl] 2-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [chloro-(2-methylbenzoyl)oxy-diphenyl-λ5-stibanyl] 2-methylbenzoate?
The IUPAC name of [chloro-(2-methylbenzoyl)oxy-diphenyl-λ5-stibanyl] 2-methylbenzoate (CID 16707993) is [chloro-(2-methylbenzoyl)oxy-diphenyl-λ5-stibanyl] 2-methylbenzoate.
What is the SMILES notation for [chloro-(2-methylbenzoyl)oxy-diphenyl-λ5-stibanyl] 2-methylbenzoate?
The canonical SMILES for [chloro-(2-methylbenzoyl)oxy-diphenyl-λ5-stibanyl] 2-methylbenzoate is Cc1ccccc1C(=O)O[Sb](Cl)(OC(=O)c1ccccc1C)(c1ccccc1)c1ccccc1.
What is the InChIKey of [chloro-(2-methylbenzoyl)oxy-diphenyl-λ5-stibanyl] 2-methylbenzoate?
The InChIKey is IMFKJBCDYSTHNJ-UHFFFAOYSA-K. The full InChI is InChI=1S/2C8H8O2.2C6H5.ClH.Sb/c2*1-6-4-2-3-5-7(6)8(9)10;2*1-2-4-6-5-3-1;;/h2*2-5H,1H3,(H,9,10);2*1-5H;1H;/q;;;;;+3/p-3.
What are the key properties of [chloro-(2-methylbenzoyl)oxy-diphenyl-λ5-stibanyl] 2-methylbenzoate?
[chloro-(2-methylbenzoyl)oxy-diphenyl-λ5-stibanyl] 2-methylbenzoate has a molecular weight of 581.71 g/mol, XLogP of 5.26, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [chloro-(2-methylbenzoyl)oxy-diphenyl-λ5-stibanyl] 2-methylbenzoate is sourced from PubChem (CID 16707993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).