C16H12Cl2FN3O — CID 167080406
4,7-dichloro-6-fluoro-1-(2-propan-2-ylphenyl)pyrido[2,3-d]pyrimidin-2-one (PubChem CID 167080406) has the molecular formula C16H12Cl2FN3O and a molecular weight of 352.20 g/mol. Its IUPAC name is 4,7-dichloro-6-fluoro-1-(2-propan-2-ylphenyl)pyrido[2,3-d]pyrimidin-2-one.
| Compound Name | 4,7-dichloro-6-fluoro-1-(2-propan-2-ylphenyl)pyrido[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 167080406 |
| Molecular Formula | C16H12Cl2FN3O |
| Molecular Weight | 352.20 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | 4,7-dichloro-6-fluoro-1-(2-propan-2-ylphenyl)pyrido[2,3-d]pyrimidin-2-one |
| SMILES | CC(C)c1ccccc1-n1c(=O)nc(Cl)c2cc(F)c(Cl)nc21 |
| InChI | InChI=1S/C16H12Cl2FN3O/c1-8(2)9-5-3-4-6-12(9)22-15-10(13(17)21-16(22)23)7-11(19)14(18)20-15/h3-8H,1-2H3 |
| InChIKey | YIJKHZQBYKUDRD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.20 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|