C20H16ClF2N3O — CID 58818107
1-[6-(3-chloro-2-ethylphenyl)-2-pyridinyl]-1-(2,6-difluorophenyl)urea (PubChem CID 58818107) has the molecular formula C20H16ClF2N3O and a molecular weight of 387.82 g/mol. Its IUPAC name is 1-[6-(3-chloro-2-ethylphenyl)-2-pyridinyl]-1-(2,6-difluorophenyl)urea.
| Compound Name | 1-[6-(3-chloro-2-ethylphenyl)-2-pyridinyl]-1-(2,6-difluorophenyl)urea |
|---|---|
| PubChem CID | 58818107 |
| Molecular Formula | C20H16ClF2N3O |
| Molecular Weight | 387.82 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 1-[6-(3-chloro-2-ethylphenyl)-2-pyridinyl]-1-(2,6-difluorophenyl)urea |
| SMILES | CCc1c(Cl)cccc1-c1cccc(N(C(N)=O)c2c(F)cccc2F)n1 |
| InChI | InChI=1S/C20H16ClF2N3O/c1-2-12-13(6-3-7-14(12)21)17-10-5-11-18(25-17)26(20(24)27)19-15(22)8-4-9-16(19)23/h3-11H,2H2,1H3,(H2,24,27) |
| InChIKey | DEHAEARSTSOEDX-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.82 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |