C27H29N7O3 — CID 167081938
3-[2-(2-cyclopropyl-1-methylbenzimidazol-5-yl)ethynyl]-1-[(3S,5E)-5-(methoxymethylidene)-1-prop-2-enoylpyrrolidin-3-yl]-5-(methylamino)pyrazole-4-carboxamide (PubChem CID 167081938) has the molecular formula C27H29N7O3 and a molecular weight of 499.58 g/mol. Its IUPAC name is 3-[2-(2-cyclopropyl-1-methylbenzimidazol-5-yl)ethynyl]-1-[(3S,5E)-5-(methoxymethylidene)-1-prop-2-enoylpyrrolidin-3-yl]-5-(methylamino)pyrazole-4-carboxamide.
| Compound Name | 3-[2-(2-cyclopropyl-1-methylbenzimidazol-5-yl)ethynyl]-1-[(3S,5E)-5-(methoxymethylidene)-1-prop-2-enoylpyrrolidin-3-yl]-5-(methylamino)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 167081938 |
| Molecular Formula | C27H29N7O3 |
| Molecular Weight | 499.58 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | 3-[2-(2-cyclopropyl-1-methylbenzimidazol-5-yl)ethynyl]-1-[(3S,5E)-5-(methoxymethylidene)-1-prop-2-enoylpyrrolidin-3-yl]-5-(methylamino)pyrazole-4-carboxamide |
| SMILES | C=CC(=O)N1C[C@@H](n2nc(C#Cc3ccc4c(c3)nc(C3CC3)n4C)c(C(N)=O)c2NC)C/C1=C\OC |
| InChI | InChI=1S/C27H29N7O3/c1-5-23(35)33-14-18(13-19(33)15-37-4)34-27(29-2)24(25(28)36)20(31-34)10-6-16-7-11-22-21(12-16)30-26(32(22)3)17-8-9-17/h5,7,11-12,15,17-18,29H,1,8-9,13-14H2,2-4H3,(H2,28,36)/b19-15+/t18-/m0/s1 |
| InChIKey | HUIYAWKZNITZMZ-CMAIMYMYSA-N |
| XLogP | 2.63 |
| TPSA | 120.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.58 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|