C25H26FN7O3 — CID 167081984
3-[2-(3-ethyl-4-fluorobenzimidazol-5-yl)ethynyl]-1-[(3S,5E)-5-(methoxymethylidene)-1-prop-2-enoylpyrrolidin-3-yl]-5-(methylamino)pyrazole-4-carboxamide (PubChem CID 167081984) has the molecular formula C25H26FN7O3 and a molecular weight of 491.53 g/mol. Its IUPAC name is 3-[2-(3-ethyl-4-fluorobenzimidazol-5-yl)ethynyl]-1-[(3S,5E)-5-(methoxymethylidene)-1-prop-2-enoylpyrrolidin-3-yl]-5-(methylamino)pyrazole-4-carboxamide.
| Compound Name | 3-[2-(3-ethyl-4-fluorobenzimidazol-5-yl)ethynyl]-1-[(3S,5E)-5-(methoxymethylidene)-1-prop-2-enoylpyrrolidin-3-yl]-5-(methylamino)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 167081984 |
| Molecular Formula | C25H26FN7O3 |
| Molecular Weight | 491.53 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | 3-[2-(3-ethyl-4-fluorobenzimidazol-5-yl)ethynyl]-1-[(3S,5E)-5-(methoxymethylidene)-1-prop-2-enoylpyrrolidin-3-yl]-5-(methylamino)pyrazole-4-carboxamide |
| SMILES | C=CC(=O)N1C[C@@H](n2nc(C#Cc3ccc4ncn(CC)c4c3F)c(C(N)=O)c2NC)C/C1=C\OC |
| InChI | InChI=1S/C25H26FN7O3/c1-5-20(34)32-12-16(11-17(32)13-36-4)33-25(28-3)21(24(27)35)18(30-33)9-7-15-8-10-19-23(22(15)26)31(6-2)14-29-19/h5,8,10,13-14,16,28H,1,6,11-12H2,2-4H3,(H2,27,35)/b17-13+/t16-/m0/s1 |
| InChIKey | SPSJIXWKOMKQOW-YKBBIGDRSA-N |
| XLogP | 2.38 |
| TPSA | 120.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.53 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|