C18H30N2 — CID 167082295
N,N-dimethyl-1-[(2E,3Z)-6-methyl-2-prop-2-enylidenehepta-3,6-dienyl]piperidin-4-amine (PubChem CID 167082295) has the molecular formula C18H30N2 and a molecular weight of 274.45 g/mol. Its IUPAC name is N,N-dimethyl-1-[(2E,3Z)-6-methyl-2-prop-2-enylidenehepta-3,6-dienyl]piperidin-4-amine.
| Compound Name | N,N-dimethyl-1-[(2E,3Z)-6-methyl-2-prop-2-enylidenehepta-3,6-dienyl]piperidin-4-amine |
|---|---|
| PubChem CID | 167082295 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | N,N-dimethyl-1-[(2E,3Z)-6-methyl-2-prop-2-enylidenehepta-3,6-dienyl]piperidin-4-amine |
| SMILES | C=C/C=C(\C=C/CC(=C)C)CN1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C18H30N2/c1-6-8-17(10-7-9-16(2)3)15-20-13-11-18(12-14-20)19(4)5/h6-8,10,18H,1-2,9,11-15H2,3-5H3/b10-7-,17-8+ |
| InChIKey | GSNMLEVMOUFPCJ-FBZDSWJDSA-N |
| XLogP | 3.65 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|