C9H16IN — CID 167089900
(2R,3S)-3-cyclopropyl-1-iodo-2-methylpiperidine (PubChem CID 167089900) has the molecular formula C9H16IN and a molecular weight of 265.14 g/mol. Its IUPAC name is (2R,3S)-3-cyclopropyl-1-iodo-2-methylpiperidine.
| Compound Name | (2R,3S)-3-cyclopropyl-1-iodo-2-methylpiperidine |
|---|---|
| PubChem CID | 167089900 |
| Molecular Formula | C9H16IN |
| Molecular Weight | 265.14 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | (2R,3S)-3-cyclopropyl-1-iodo-2-methylpiperidine |
| SMILES | C[C@@H]1[C@H](C2CC2)CCCN1I |
| InChI | InChI=1S/C9H16IN/c1-7-9(8-4-5-8)3-2-6-11(7)10/h7-9H,2-6H2,1H3/t7-,9-/m1/s1 |
| InChIKey | BMYFUOZHLGQALJ-VXNVDRBHSA-N |
| XLogP | 2.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.14 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|