C10H16O3 — CID 167090767
[(1R)-2-(1-hydroxyprop-2-enyl)cyclobutyl]methyl acetate (PubChem CID 167090767) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is [(1R)-2-(1-hydroxyprop-2-enyl)cyclobutyl]methyl acetate.
| Compound Name | [(1R)-2-(1-hydroxyprop-2-enyl)cyclobutyl]methyl acetate |
|---|---|
| PubChem CID | 167090767 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | [(1R)-2-(1-hydroxyprop-2-enyl)cyclobutyl]methyl acetate |
| SMILES | C=CC(O)C1CC[C@H]1COC(C)=O |
| InChI | InChI=1S/C10H16O3/c1-3-10(12)9-5-4-8(9)6-13-7(2)11/h3,8-10,12H,1,4-6H2,2H3/t8-,9?,10?/m0/s1 |
| InChIKey | QUVWYOMVPMYPJD-IDKOKCKLSA-N |
| XLogP | 1.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|