C22H25ClN4O3S2 — CID 167090794
N'-[4-(5-chloro-1,3-benzothiazol-2-yl)cyclohexyl]-5-(cyclobutylsulfamoyl)furan-2-carboximidamide (PubChem CID 167090794) has the molecular formula C22H25ClN4O3S2 and a molecular weight of 493.05 g/mol. Its IUPAC name is N'-[4-(5-chloro-1,3-benzothiazol-2-yl)cyclohexyl]-5-(cyclobutylsulfamoyl)furan-2-carboximidamide.
| Compound Name | N'-[4-(5-chloro-1,3-benzothiazol-2-yl)cyclohexyl]-5-(cyclobutylsulfamoyl)furan-2-carboximidamide |
|---|---|
| PubChem CID | 167090794 |
| Molecular Formula | C22H25ClN4O3S2 |
| Molecular Weight | 493.05 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | N'-[4-(5-chloro-1,3-benzothiazol-2-yl)cyclohexyl]-5-(cyclobutylsulfamoyl)furan-2-carboximidamide |
| SMILES | N/C(=N\C1CCC(c2nc3cc(Cl)ccc3s2)CC1)c1ccc(S(=O)(=O)NC2CCC2)o1 |
| InChI | InChI=1S/C22H25ClN4O3S2/c23-14-6-10-19-17(12-14)26-22(31-19)13-4-7-15(8-5-13)25-21(24)18-9-11-20(30-18)32(28,29)27-16-2-1-3-16/h6,9-13,15-16,27H,1-5,7-8H2,(H2,24,25) |
| InChIKey | SQVPQMVRASBUQQ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 110.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.05 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|