C21H31NO6 — CID 167090958
3-[5-methyl-5-(3-methylbutoxy)-4-oxohexanoyl]oxypropyl pyridine-3-carboxylate (PubChem CID 167090958) has the molecular formula C21H31NO6 and a molecular weight of 393.48 g/mol. Its IUPAC name is 3-[5-methyl-5-(3-methylbutoxy)-4-oxohexanoyl]oxypropyl pyridine-3-carboxylate.
| Compound Name | 3-[5-methyl-5-(3-methylbutoxy)-4-oxohexanoyl]oxypropyl pyridine-3-carboxylate |
|---|---|
| PubChem CID | 167090958 |
| Molecular Formula | C21H31NO6 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 3-[5-methyl-5-(3-methylbutoxy)-4-oxohexanoyl]oxypropyl pyridine-3-carboxylate |
| SMILES | CC(C)CCOC(C)(C)C(=O)CCC(=O)OCCCOC(=O)c1cccnc1 |
| InChI | InChI=1S/C21H31NO6/c1-16(2)10-14-28-21(3,4)18(23)8-9-19(24)26-12-6-13-27-20(25)17-7-5-11-22-15-17/h5,7,11,15-16H,6,8-10,12-14H2,1-4H3 |
| InChIKey | RJIXELBMONJYBM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 91.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|