C18H32IN3 — CID 167091283
3-[(7-iodo-7-azaspiro[3.5]nonan-2-yl)methyl]-3,9-diazaspiro[5.5]undecane (PubChem CID 167091283) has the molecular formula C18H32IN3 and a molecular weight of 417.38 g/mol. Its IUPAC name is 3-[(7-iodo-7-azaspiro[3.5]nonan-2-yl)methyl]-3,9-diazaspiro[5.5]undecane.
| Compound Name | 3-[(7-iodo-7-azaspiro[3.5]nonan-2-yl)methyl]-3,9-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 167091283 |
| Molecular Formula | C18H32IN3 |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 3-[(7-iodo-7-azaspiro[3.5]nonan-2-yl)methyl]-3,9-diazaspiro[5.5]undecane |
| SMILES | IN1CCC2(CC1)CC(CN1CCC3(CCNCC3)CC1)C2 |
| InChI | InChI=1S/C18H32IN3/c19-22-11-5-18(6-12-22)13-16(14-18)15-21-9-3-17(4-10-21)1-7-20-8-2-17/h16,20H,1-15H2 |
| InChIKey | XBQIMYSWKDRJEE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|