C14H27N3 — CID 162741768
3-(pyrrolidin-3-ylmethyl)-3,9-diazaspiro[5.5]undecane (PubChem CID 162741768) has the molecular formula C14H27N3 and a molecular weight of 237.39 g/mol. Its IUPAC name is 3-(pyrrolidin-3-ylmethyl)-3,9-diazaspiro[5.5]undecane.
| Compound Name | 3-(pyrrolidin-3-ylmethyl)-3,9-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 162741768 |
| Molecular Formula | C14H27N3 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.22 |
| IUPAC Name | 3-(pyrrolidin-3-ylmethyl)-3,9-diazaspiro[5.5]undecane |
| SMILES | C1CC2(CCN1)CCN(CC1CCNC1)CC2 |
| InChI | InChI=1S/C14H27N3/c1-6-16-11-13(1)12-17-9-4-14(5-10-17)2-7-15-8-3-14/h13,15-16H,1-12H2 |
| InChIKey | ANVQWCKQWKGOMH-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |