C13H32N4 — CID 167093285
N'-tert-butyl-N-[2-[dimethylamino(methyl)amino]ethyl]-N,N'-dimethylethane-1,2-diamine (PubChem CID 167093285) has the molecular formula C13H32N4 and a molecular weight of 244.43 g/mol. Its IUPAC name is N'-tert-butyl-N-[2-[dimethylamino(methyl)amino]ethyl]-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N'-tert-butyl-N-[2-[dimethylamino(methyl)amino]ethyl]-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 167093285 |
| Molecular Formula | C13H32N4 |
| Molecular Weight | 244.43 g/mol |
| Exact Mass | 244.26 |
| IUPAC Name | N'-tert-butyl-N-[2-[dimethylamino(methyl)amino]ethyl]-N,N'-dimethylethane-1,2-diamine |
| SMILES | CN(CCN(C)N(C)C)CCN(C)C(C)(C)C |
| InChI | InChI=1S/C13H32N4/c1-13(2,3)16(7)11-9-15(6)10-12-17(8)14(4)5/h9-12H2,1-8H3 |
| InChIKey | DOZSFKZHEQSSEU-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.43 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|