C22H50N4S2 — CID 174334503
N,N'-bis[2-[2-[tert-butyl(methyl)amino]ethylsulfanyl]ethyl]-N,N'-dimethylethane-1,2-diamine (PubChem CID 174334503) has the molecular formula C22H50N4S2 and a molecular weight of 434.80 g/mol. Its IUPAC name is N,N'-bis[2-[2-[tert-butyl(methyl)amino]ethylsulfanyl]ethyl]-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N,N'-bis[2-[2-[tert-butyl(methyl)amino]ethylsulfanyl]ethyl]-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 174334503 |
| Molecular Formula | C22H50N4S2 |
| Molecular Weight | 434.80 g/mol |
| Exact Mass | 434.35 |
| IUPAC Name | N,N'-bis[2-[2-[tert-butyl(methyl)amino]ethylsulfanyl]ethyl]-N,N'-dimethylethane-1,2-diamine |
| SMILES | CN(CCSCCN(C)C(C)(C)C)CCN(C)CCSCCN(C)C(C)(C)C |
| InChI | InChI=1S/C22H50N4S2/c1-21(2,3)25(9)15-19-27-17-13-23(7)11-12-24(8)14-18-28-20-16-26(10)22(4,5)6/h11-20H2,1-10H3 |
| InChIKey | ORVRLNBRDMAYNO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.80 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|