C24H21N5S2 — CID 167094852
2-[[10-(2,2-dicyanoethenyl)-7-(2-ethylhexyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]methylidene]propanedinitrile (PubChem CID 167094852) has the molecular formula C24H21N5S2 and a molecular weight of 443.60 g/mol. Its IUPAC name is 2-[[10-(2,2-dicyanoethenyl)-7-(2-ethylhexyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]methylidene]propanedinitrile.
| Compound Name | 2-[[10-(2,2-dicyanoethenyl)-7-(2-ethylhexyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 167094852 |
| Molecular Formula | C24H21N5S2 |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 2-[[10-(2,2-dicyanoethenyl)-7-(2-ethylhexyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]methylidene]propanedinitrile |
| SMILES | CCCCC(CC)Cn1c2cc(C=C(C#N)C#N)sc2c2sc(C=C(C#N)C#N)cc21 |
| InChI | InChI=1S/C24H21N5S2/c1-3-5-6-16(4-2)15-29-21-9-19(7-17(11-25)12-26)30-23(21)24-22(29)10-20(31-24)8-18(13-27)14-28/h7-10,16H,3-6,15H2,1-2H3 |
| InChIKey | RDSFDDGWYBBTAF-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 100.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|