C48H47N3O2 — CID 158249822
(Z)-2-[4-[(Z)-1-cyano-2-[4-[9-(2-ethylhexyl)-6-(4-methylphenyl)carbazol-3-yl]phenyl]ethenyl]-2,5-dimethoxyphenyl]but-2-enenitrile (PubChem CID 158249822) has the molecular formula C48H47N3O2 and a molecular weight of 697.92 g/mol. Its IUPAC name is (Z)-2-[4-[(Z)-1-cyano-2-[4-[9-(2-ethylhexyl)-6-(4-methylphenyl)carbazol-3-yl]phenyl]ethenyl]-2,5-dimethoxyphenyl]but-2-enenitrile.
| Compound Name | (Z)-2-[4-[(Z)-1-cyano-2-[4-[9-(2-ethylhexyl)-6-(4-methylphenyl)carbazol-3-yl]phenyl]ethenyl]-2,5-dimethoxyphenyl]but-2-enenitrile |
|---|---|
| PubChem CID | 158249822 |
| Molecular Formula | C48H47N3O2 |
| Molecular Weight | 697.92 g/mol |
| Exact Mass | 697.37 |
| IUPAC Name | (Z)-2-[4-[(Z)-1-cyano-2-[4-[9-(2-ethylhexyl)-6-(4-methylphenyl)carbazol-3-yl]phenyl]ethenyl]-2,5-dimethoxyphenyl]but-2-enenitrile |
| SMILES | C/C=C(\C#N)c1cc(OC)c(/C(C#N)=C/c2ccc(-c3ccc4c(c3)c3cc(-c5ccc(C)cc5)ccc3n4CC(CC)CCCC)cc2)cc1OC |
| InChI | InChI=1S/C48H47N3O2/c1-7-10-11-33(8-2)31-51-45-22-20-38(36-16-12-32(4)13-17-36)25-43(45)44-26-39(21-23-46(44)51)37-18-14-34(15-19-37)24-40(30-50)42-28-47(52-5)41(27-48(42)53-6)35(9-3)29-49/h9,12-28,33H,7-8,10-11,31H2,1-6H3/b35-9+,40-24+ |
| InChIKey | PHOKSDWJSQAESF-IKIGEFLZSA-N |
| XLogP | 12.66 |
| TPSA | 70.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.92 |
| LogP ≤ 5 | 12.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|