C38H46N4S2 — CID 146326581
2-[(2E,4E)-5-[5-[5-(2,2-dicyanoethenyl)thiophen-2-yl]-3,4-bis(2-ethylhexyl)thiophen-2-yl]-2-methylhexa-2,4-dienylidene]propanedinitrile (PubChem CID 146326581) has the molecular formula C38H46N4S2 and a molecular weight of 622.95 g/mol. Its IUPAC name is 2-[(2E,4E)-5-[5-[5-(2,2-dicyanoethenyl)thiophen-2-yl]-3,4-bis(2-ethylhexyl)thiophen-2-yl]-2-methylhexa-2,4-dienylidene]propanedinitrile.
| Compound Name | 2-[(2E,4E)-5-[5-[5-(2,2-dicyanoethenyl)thiophen-2-yl]-3,4-bis(2-ethylhexyl)thiophen-2-yl]-2-methylhexa-2,4-dienylidene]propanedinitrile |
|---|---|
| PubChem CID | 146326581 |
| Molecular Formula | C38H46N4S2 |
| Molecular Weight | 622.95 g/mol |
| Exact Mass | 622.32 |
| IUPAC Name | 2-[(2E,4E)-5-[5-[5-(2,2-dicyanoethenyl)thiophen-2-yl]-3,4-bis(2-ethylhexyl)thiophen-2-yl]-2-methylhexa-2,4-dienylidene]propanedinitrile |
| SMILES | CCCCC(CC)Cc1c(/C(C)=C/C=C(\C)C=C(C#N)C#N)sc(-c2ccc(C=C(C#N)C#N)s2)c1CC(CC)CCCC |
| InChI | InChI=1S/C38H46N4S2/c1-7-11-13-29(9-3)21-34-35(22-30(10-4)14-12-8-2)38(36-18-17-33(43-36)20-32(25-41)26-42)44-37(34)28(6)16-15-27(5)19-31(23-39)24-40/h15-20,29-30H,7-14,21-22H2,1-6H3/b27-15+,28-16+ |
| InChIKey | BHDYZFSDBZAMGL-DPCVLPDWSA-N |
| XLogP | 11.75 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.95 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|