C23H29N — CID 167095024
(5Z)-2-methyl-5-[2-methyl-5-(2-phenylethyl)phenyl]hepta-1,5-dien-3-amine (PubChem CID 167095024) has the molecular formula C23H29N and a molecular weight of 319.49 g/mol. Its IUPAC name is (5Z)-2-methyl-5-[2-methyl-5-(2-phenylethyl)phenyl]hepta-1,5-dien-3-amine.
| Compound Name | (5Z)-2-methyl-5-[2-methyl-5-(2-phenylethyl)phenyl]hepta-1,5-dien-3-amine |
|---|---|
| PubChem CID | 167095024 |
| Molecular Formula | C23H29N |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | (5Z)-2-methyl-5-[2-methyl-5-(2-phenylethyl)phenyl]hepta-1,5-dien-3-amine |
| SMILES | C=C(C)C(N)C/C(=C/C)c1cc(CCc2ccccc2)ccc1C |
| InChI | InChI=1S/C23H29N/c1-5-21(16-23(24)17(2)3)22-15-20(12-11-18(22)4)14-13-19-9-7-6-8-10-19/h5-12,15,23H,2,13-14,16,24H2,1,3-4H3/b21-5- |
| InChIKey | YRZTURISJMEYKC-SQFVCTCFSA-N |
| XLogP | 5.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|