C44H36N2O2S2 — CID 167096976
(E)-1-[(4R)-2,4-diphenyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]-3-[3-[(4S)-4-phenyl-6-prop-2-enoyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl]phenyl]prop-2-en-1-one (PubChem CID 167096976) has the molecular formula C44H36N2O2S2 and a molecular weight of 688.92 g/mol. Its IUPAC name is (E)-1-[(4R)-2,4-diphenyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]-3-[3-[(4S)-4-phenyl-6-prop-2-enoyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl]phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[(4R)-2,4-diphenyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]-3-[3-[(4S)-4-phenyl-6-prop-2-enoyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 167096976 |
| Molecular Formula | C44H36N2O2S2 |
| Molecular Weight | 688.92 g/mol |
| Exact Mass | 688.22 |
| IUPAC Name | (E)-1-[(4R)-2,4-diphenyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]-3-[3-[(4S)-4-phenyl-6-prop-2-enoyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl]phenyl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1Cc2sc(-c3cccc(/C=C/C(=O)N4Cc5sc(-c6ccccc6)cc5[C@@H](c5ccccc5)C4)c3)cc2[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C44H36N2O2S2/c1-2-43(47)45-26-37(31-14-6-3-7-15-31)36-25-40(50-41(36)28-45)34-20-12-13-30(23-34)21-22-44(48)46-27-38(32-16-8-4-9-17-32)35-24-39(49-42(35)29-46)33-18-10-5-11-19-33/h2-25,37-38H,1,26-29H2/b22-21+/t37-,38+/m0/s1 |
| InChIKey | QXVGPTXJCYFTSS-IQSHZODZSA-N |
| XLogP | 9.99 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.92 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|