C19H25IO2 — CID 167099222
benzyl 2-[(3aR)-3-iodo-1,4-dimethyl-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]acetate (PubChem CID 167099222) has the molecular formula C19H25IO2 and a molecular weight of 412.31 g/mol. Its IUPAC name is benzyl 2-[(3aR)-3-iodo-1,4-dimethyl-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]acetate.
| Compound Name | benzyl 2-[(3aR)-3-iodo-1,4-dimethyl-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]acetate |
|---|---|
| PubChem CID | 167099222 |
| Molecular Formula | C19H25IO2 |
| Molecular Weight | 412.31 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | benzyl 2-[(3aR)-3-iodo-1,4-dimethyl-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]acetate |
| SMILES | CC1C(CC(=O)OCc2ccccc2)C(I)[C@@H]2C(C)CCC12 |
| InChI | InChI=1S/C19H25IO2/c1-12-8-9-15-13(2)16(19(20)18(12)15)10-17(21)22-11-14-6-4-3-5-7-14/h3-7,12-13,15-16,18-19H,8-11H2,1-2H3/t12?,13?,15?,16?,18-,19?/m1/s1 |
| InChIKey | JJIWJIISERJMJE-VORIMKGTSA-N |
| XLogP | 4.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.31 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|