C25H29F2N5O2 — CID 167099245
N-[4-[[2-(1,1-difluoroethyl)-6-methylquinolin-4-yl]amino]cyclohexyl]-1,4,6,7-tetrahydropyrano[4,3-c]pyrazole-3-carboxamide (PubChem CID 167099245) has the molecular formula C25H29F2N5O2 and a molecular weight of 469.54 g/mol. Its IUPAC name is N-[4-[[2-(1,1-difluoroethyl)-6-methylquinolin-4-yl]amino]cyclohexyl]-1,4,6,7-tetrahydropyrano[4,3-c]pyrazole-3-carboxamide.
| Compound Name | N-[4-[[2-(1,1-difluoroethyl)-6-methylquinolin-4-yl]amino]cyclohexyl]-1,4,6,7-tetrahydropyrano[4,3-c]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 167099245 |
| Molecular Formula | C25H29F2N5O2 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | N-[4-[[2-(1,1-difluoroethyl)-6-methylquinolin-4-yl]amino]cyclohexyl]-1,4,6,7-tetrahydropyrano[4,3-c]pyrazole-3-carboxamide |
| SMILES | Cc1ccc2nc(C(C)(F)F)cc(NC3CCC(NC(=O)c4n[nH]c5c4COCC5)CC3)c2c1 |
| InChI | InChI=1S/C25H29F2N5O2/c1-14-3-8-19-17(11-14)21(12-22(30-19)25(2,26)27)28-15-4-6-16(7-5-15)29-24(33)23-18-13-34-10-9-20(18)31-32-23/h3,8,11-12,15-16H,4-7,9-10,13H2,1-2H3,(H,28,30)(H,29,33)(H,31,32) |
| InChIKey | ZOFXMCXEBRQPKQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |