C25H31N3O2 — CID 167099451
N-[4-[(2-tert-butyl-6-methylquinolin-4-yl)amino]cyclohexyl]furan-3-carboxamide (PubChem CID 167099451) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is N-[4-[(2-tert-butyl-6-methylquinolin-4-yl)amino]cyclohexyl]furan-3-carboxamide.
| Compound Name | N-[4-[(2-tert-butyl-6-methylquinolin-4-yl)amino]cyclohexyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 167099451 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | N-[4-[(2-tert-butyl-6-methylquinolin-4-yl)amino]cyclohexyl]furan-3-carboxamide |
| SMILES | Cc1ccc2nc(C(C)(C)C)cc(NC3CCC(NC(=O)c4ccoc4)CC3)c2c1 |
| InChI | InChI=1S/C25H31N3O2/c1-16-5-10-21-20(13-16)22(14-23(28-21)25(2,3)4)26-18-6-8-19(9-7-18)27-24(29)17-11-12-30-15-17/h5,10-15,18-19H,6-9H2,1-4H3,(H,26,28)(H,27,29) |
| InChIKey | AFTHFDKROZLGFP-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |