C24H30BN5O — CID 174011113
CID 174011113 (PubChem CID 174011113) has the molecular formula C24H30BN5O and a molecular weight of 415.35 g/mol.
| Compound Name | CID 174011113 |
|---|---|
| PubChem CID | 174011113 |
| Molecular Formula | C24H30BN5O |
| Molecular Weight | 415.35 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | — |
| SMILES | [B]c1cnn(C)c1C(=O)NC1CCC(Nc2cc(C(C)C)nc3ccc(C)cc23)CC1 |
| InChI | InChI=1S/C24H30BN5O/c1-14(2)21-12-22(18-11-15(3)5-10-20(18)29-21)27-16-6-8-17(9-7-16)28-24(31)23-19(25)13-26-30(23)4/h5,10-14,16-17H,6-9H2,1-4H3,(H,27,29)(H,28,31) |
| InChIKey | SPIVFUNRDOZATF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|