C25H31N5O — CID 167099312
(E)-3-(1H-imidazol-5-yl)-N-[4-[(6-methyl-2-propan-2-ylquinolin-4-yl)amino]cyclohexyl]prop-2-enamide (PubChem CID 167099312) has the molecular formula C25H31N5O and a molecular weight of 417.56 g/mol. Its IUPAC name is (E)-3-(1H-imidazol-5-yl)-N-[4-[(6-methyl-2-propan-2-ylquinolin-4-yl)amino]cyclohexyl]prop-2-enamide.
| Compound Name | (E)-3-(1H-imidazol-5-yl)-N-[4-[(6-methyl-2-propan-2-ylquinolin-4-yl)amino]cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 167099312 |
| Molecular Formula | C25H31N5O |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | (E)-3-(1H-imidazol-5-yl)-N-[4-[(6-methyl-2-propan-2-ylquinolin-4-yl)amino]cyclohexyl]prop-2-enamide |
| SMILES | Cc1ccc2nc(C(C)C)cc(NC3CCC(NC(=O)/C=C/c4cnc[nH]4)CC3)c2c1 |
| InChI | InChI=1S/C25H31N5O/c1-16(2)23-13-24(21-12-17(3)4-10-22(21)30-23)28-18-5-7-19(8-6-18)29-25(31)11-9-20-14-26-15-27-20/h4,9-16,18-19H,5-8H2,1-3H3,(H,26,27)(H,28,30)(H,29,31)/b11-9+ |
| InChIKey | NAJNIHUNQYSBLE-PKNBQFBNSA-N |
| XLogP | 4.94 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|