C24H30IN5O — CID 167099239
4-iodo-1-methyl-N-[4-[(6-methyl-2-propan-2-ylquinolin-4-yl)amino]cyclohexyl]pyrazole-3-carboxamide (PubChem CID 167099239) has the molecular formula C24H30IN5O and a molecular weight of 531.44 g/mol. Its IUPAC name is 4-iodo-1-methyl-N-[4-[(6-methyl-2-propan-2-ylquinolin-4-yl)amino]cyclohexyl]pyrazole-3-carboxamide.
| Compound Name | 4-iodo-1-methyl-N-[4-[(6-methyl-2-propan-2-ylquinolin-4-yl)amino]cyclohexyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 167099239 |
| Molecular Formula | C24H30IN5O |
| Molecular Weight | 531.44 g/mol |
| Exact Mass | 531.15 |
| IUPAC Name | 4-iodo-1-methyl-N-[4-[(6-methyl-2-propan-2-ylquinolin-4-yl)amino]cyclohexyl]pyrazole-3-carboxamide |
| SMILES | Cc1ccc2nc(C(C)C)cc(NC3CCC(NC(=O)c4nn(C)cc4I)CC3)c2c1 |
| InChI | InChI=1S/C24H30IN5O/c1-14(2)21-12-22(18-11-15(3)5-10-20(18)28-21)26-16-6-8-17(9-7-16)27-24(31)23-19(25)13-30(4)29-23/h5,10-14,16-17H,6-9H2,1-4H3,(H,26,28)(H,27,31) |
| InChIKey | RWGYGACIKXUPPD-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.44 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|