C31H35FN4O3 — CID 167099517
4-(1,3-dioxoisoindol-2-yl)-N-[4-[[2-(2-fluoropropan-2-yl)-6-methylquinolin-4-yl]amino]cyclohexyl]butanamide (PubChem CID 167099517) has the molecular formula C31H35FN4O3 and a molecular weight of 530.64 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-N-[4-[[2-(2-fluoropropan-2-yl)-6-methylquinolin-4-yl]amino]cyclohexyl]butanamide.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-N-[4-[[2-(2-fluoropropan-2-yl)-6-methylquinolin-4-yl]amino]cyclohexyl]butanamide |
|---|---|
| PubChem CID | 167099517 |
| Molecular Formula | C31H35FN4O3 |
| Molecular Weight | 530.64 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-N-[4-[[2-(2-fluoropropan-2-yl)-6-methylquinolin-4-yl]amino]cyclohexyl]butanamide |
| SMILES | Cc1ccc2nc(C(C)(C)F)cc(NC3CCC(NC(=O)CCCN4C(=O)c5ccccc5C4=O)CC3)c2c1 |
| InChI | InChI=1S/C31H35FN4O3/c1-19-10-15-25-24(17-19)26(18-27(35-25)31(2,3)32)33-20-11-13-21(14-12-20)34-28(37)9-6-16-36-29(38)22-7-4-5-8-23(22)30(36)39/h4-5,7-8,10,15,17-18,20-21H,6,9,11-14,16H2,1-3H3,(H,33,35)(H,34,37) |
| InChIKey | DDDRXEKWBXEBSH-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.64 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|