C11H23N — CID 167099818
(E)-N,4-dimethyl-N-(2-methylpropyl)pent-2-en-1-amine (PubChem CID 167099818) has the molecular formula C11H23N and a molecular weight of 169.31 g/mol. Its IUPAC name is (E)-N,4-dimethyl-N-(2-methylpropyl)pent-2-en-1-amine.
| Compound Name | (E)-N,4-dimethyl-N-(2-methylpropyl)pent-2-en-1-amine |
|---|---|
| PubChem CID | 167099818 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | (E)-N,4-dimethyl-N-(2-methylpropyl)pent-2-en-1-amine |
| SMILES | CC(C)/C=C/CN(C)CC(C)C |
| InChI | InChI=1S/C11H23N/c1-10(2)7-6-8-12(5)9-11(3)4/h6-7,10-11H,8-9H2,1-5H3/b7-6+ |
| InChIKey | MXPYSRIUAMIHIY-VOTSOKGWSA-N |
| XLogP | 2.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|