C28H23N3O5 — CID 167100228
1-[2,4,6-trioxo-3,5-bis(prop-2-ynyl)-1,3,5-triazinan-1-yl]butan-2-yl anthracene-2-carboxylate (PubChem CID 167100228) has the molecular formula C28H23N3O5 and a molecular weight of 481.51 g/mol. Its IUPAC name is 1-[2,4,6-trioxo-3,5-bis(prop-2-ynyl)-1,3,5-triazinan-1-yl]butan-2-yl anthracene-2-carboxylate.
| Compound Name | 1-[2,4,6-trioxo-3,5-bis(prop-2-ynyl)-1,3,5-triazinan-1-yl]butan-2-yl anthracene-2-carboxylate |
|---|---|
| PubChem CID | 167100228 |
| Molecular Formula | C28H23N3O5 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 1-[2,4,6-trioxo-3,5-bis(prop-2-ynyl)-1,3,5-triazinan-1-yl]butan-2-yl anthracene-2-carboxylate |
| SMILES | C#CCn1c(=O)n(CC#C)c(=O)n(CC(CC)OC(=O)c2ccc3cc4ccccc4cc3c2)c1=O |
| InChI | InChI=1S/C28H23N3O5/c1-4-13-29-26(33)30(14-5-2)28(35)31(27(29)34)18-24(6-3)36-25(32)22-12-11-21-15-19-9-7-8-10-20(19)16-23(21)17-22/h1-2,7-12,15-17,24H,6,13-14,18H2,3H3 |
| InChIKey | RFYGDFIYCMKLFC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|