C14H23NO — CID 167103883
6,8-dimethyl-2,3,4,4a,6,7,8,9a,10,10a-decahydro-1H-pyrido[1,2-a]indol-9-one (PubChem CID 167103883) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 6,8-dimethyl-2,3,4,4a,6,7,8,9a,10,10a-decahydro-1H-pyrido[1,2-a]indol-9-one.
| Compound Name | 6,8-dimethyl-2,3,4,4a,6,7,8,9a,10,10a-decahydro-1H-pyrido[1,2-a]indol-9-one |
|---|---|
| PubChem CID | 167103883 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 6,8-dimethyl-2,3,4,4a,6,7,8,9a,10,10a-decahydro-1H-pyrido[1,2-a]indol-9-one |
| SMILES | CC1CC(C)N2C(CC3CCCCC32)C1=O |
| InChI | InChI=1S/C14H23NO/c1-9-7-10(2)15-12-6-4-3-5-11(12)8-13(15)14(9)16/h9-13H,3-8H2,1-2H3 |
| InChIKey | WIIVBUITTZOOPE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |