C9H19N3 — CID 129109705
[(2R,7aS)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]hydrazine (PubChem CID 129109705) has the molecular formula C9H19N3 and a molecular weight of 169.27 g/mol. Its IUPAC name is [(2R,7aS)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]hydrazine.
| Compound Name | [(2R,7aS)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]hydrazine |
|---|---|
| PubChem CID | 129109705 |
| Molecular Formula | C9H19N3 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.16 |
| IUPAC Name | [(2R,7aS)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]hydrazine |
| SMILES | C[C@@H]1CC2CCCC[C@@H]2N1NN |
| InChI | InChI=1S/C9H19N3/c1-7-6-8-4-2-3-5-9(8)12(7)11-10/h7-9,11H,2-6,10H2,1H3/t7-,8?,9+/m1/s1 |
| InChIKey | GRXLDOGUWQZJFJ-NBXIYJJMSA-N |
| XLogP | 1.02 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|