C29H50N2O8S4 — CID 167104234
[2-[2-[3-(cyclooctyloxycarbonylamino)propylsulfanyl]ethylcarbamoyl]-5-oxo-7-sulfanyl-2-(3-sulfanylpropanoyloxymethyl)heptyl] 3-sulfanylpropanoate (PubChem CID 167104234) has the molecular formula C29H50N2O8S4 and a molecular weight of 682.99 g/mol. Its IUPAC name is [2-[2-[3-(cyclooctyloxycarbonylamino)propylsulfanyl]ethylcarbamoyl]-5-oxo-7-sulfanyl-2-(3-sulfanylpropanoyloxymethyl)heptyl] 3-sulfanylpropanoate.
| Compound Name | [2-[2-[3-(cyclooctyloxycarbonylamino)propylsulfanyl]ethylcarbamoyl]-5-oxo-7-sulfanyl-2-(3-sulfanylpropanoyloxymethyl)heptyl] 3-sulfanylpropanoate |
|---|---|
| PubChem CID | 167104234 |
| Molecular Formula | C29H50N2O8S4 |
| Molecular Weight | 682.99 g/mol |
| Exact Mass | 682.25 |
| IUPAC Name | [2-[2-[3-(cyclooctyloxycarbonylamino)propylsulfanyl]ethylcarbamoyl]-5-oxo-7-sulfanyl-2-(3-sulfanylpropanoyloxymethyl)heptyl] 3-sulfanylpropanoate |
| SMILES | O=C(CCS)CCC(COC(=O)CCS)(COC(=O)CCS)C(=O)NCCSCCCNC(=O)OC1CCCCCCC1 |
| InChI | InChI=1S/C29H50N2O8S4/c32-23(10-16-40)9-13-29(21-37-25(33)11-17-41,22-38-26(34)12-18-42)27(35)30-15-20-43-19-6-14-31-28(36)39-24-7-4-2-1-3-5-8-24/h24,40-42H,1-22H2,(H,30,35)(H,31,36) |
| InChIKey | RHYYJQFOHCYKCZ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.99 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|