C14H19FN2O — CID 167108076
(3aR,7aS)-5-benzyl-3a-fluoro-2,3,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-1-ol (PubChem CID 167108076) has the molecular formula C14H19FN2O and a molecular weight of 250.32 g/mol. Its IUPAC name is (3aR,7aS)-5-benzyl-3a-fluoro-2,3,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-1-ol.
| Compound Name | (3aR,7aS)-5-benzyl-3a-fluoro-2,3,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-1-ol |
|---|---|
| PubChem CID | 167108076 |
| Molecular Formula | C14H19FN2O |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | (3aR,7aS)-5-benzyl-3a-fluoro-2,3,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-1-ol |
| SMILES | OC1NC[C@@]2(F)CN(Cc3ccccc3)CC[C@@H]12 |
| InChI | InChI=1S/C14H19FN2O/c15-14-9-16-13(18)12(14)6-7-17(10-14)8-11-4-2-1-3-5-11/h1-5,12-13,16,18H,6-10H2/t12-,13?,14+/m0/s1 |
| InChIKey | QXIBQHNUVFALNX-SMEJFCCLSA-N |
| XLogP | 1.14 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |