C14H18N2O2 — CID 163394366
(3aS,7aS)-5-benzyl-3a-hydroxy-2,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-1-one (PubChem CID 163394366) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is (3aS,7aS)-5-benzyl-3a-hydroxy-2,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-1-one.
| Compound Name | (3aS,7aS)-5-benzyl-3a-hydroxy-2,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-1-one |
|---|---|
| PubChem CID | 163394366 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | (3aS,7aS)-5-benzyl-3a-hydroxy-2,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-1-one |
| SMILES | O=C1NC[C@]2(O)CN(Cc3ccccc3)CC[C@H]12 |
| InChI | InChI=1S/C14H18N2O2/c17-13-12-6-7-16(10-14(12,18)9-15-13)8-11-4-2-1-3-5-11/h1-5,12,18H,6-10H2,(H,15,17)/t12-,14+/m1/s1 |
| InChIKey | DIXUJVSNFOWRKB-OCCSQVGLSA-N |
| XLogP | 0.37 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |