C15H22N2O2 — CID 167108133
N-[[(3R,4R)-1-benzyl-3-hydroxy-4-methylpiperidin-3-yl]methyl]formamide (PubChem CID 167108133) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is N-[[(3R,4R)-1-benzyl-3-hydroxy-4-methylpiperidin-3-yl]methyl]formamide.
| Compound Name | N-[[(3R,4R)-1-benzyl-3-hydroxy-4-methylpiperidin-3-yl]methyl]formamide |
|---|---|
| PubChem CID | 167108133 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | N-[[(3R,4R)-1-benzyl-3-hydroxy-4-methylpiperidin-3-yl]methyl]formamide |
| SMILES | C[C@@H]1CCN(Cc2ccccc2)C[C@]1(O)CNC=O |
| InChI | InChI=1S/C15H22N2O2/c1-13-7-8-17(9-14-5-3-2-4-6-14)11-15(13,19)10-16-12-18/h2-6,12-13,19H,7-11H2,1H3,(H,16,18)/t13-,15-/m1/s1 |
| InChIKey | WYTXCHLPKKOGMR-UKRRQHHQSA-N |
| XLogP | 1.01 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|