C23H26N2O2 — CID 639291
[(3R,4S)-1-benzyl-3-ethyl-3-hydroxypiperidin-4-yl]-(1H-indol-2-yl)methanone (PubChem CID 639291) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is [(3R,4S)-1-benzyl-3-ethyl-3-hydroxypiperidin-4-yl]-(1H-indol-2-yl)methanone.
| Compound Name | [(3R,4S)-1-benzyl-3-ethyl-3-hydroxypiperidin-4-yl]-(1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 639291 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | [(3R,4S)-1-benzyl-3-ethyl-3-hydroxypiperidin-4-yl]-(1H-indol-2-yl)methanone |
| SMILES | CC[C@]1(O)CN(Cc2ccccc2)CC[C@@H]1C(=O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C23H26N2O2/c1-2-23(27)16-25(15-17-8-4-3-5-9-17)13-12-19(23)22(26)21-14-18-10-6-7-11-20(18)24-21/h3-11,14,19,24,27H,2,12-13,15-16H2,1H3/t19-,23+/m1/s1 |
| InChIKey | QGOIDPFFXICKJJ-XXBNENTESA-N |
| XLogP | 4.01 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |