C15H21ClN4OS — CID 167110055
[(4R)-1-(5-tert-butyl-4-chloro-1,3-thiazol-2-yl)-2-oxoazocan-4-yl]cyanamide (PubChem CID 167110055) has the molecular formula C15H21ClN4OS and a molecular weight of 340.88 g/mol. Its IUPAC name is [(4R)-1-(5-tert-butyl-4-chloro-1,3-thiazol-2-yl)-2-oxoazocan-4-yl]cyanamide.
| Compound Name | [(4R)-1-(5-tert-butyl-4-chloro-1,3-thiazol-2-yl)-2-oxoazocan-4-yl]cyanamide |
|---|---|
| PubChem CID | 167110055 |
| Molecular Formula | C15H21ClN4OS |
| Molecular Weight | 340.88 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | [(4R)-1-(5-tert-butyl-4-chloro-1,3-thiazol-2-yl)-2-oxoazocan-4-yl]cyanamide |
| SMILES | CC(C)(C)c1sc(N2CCCC[C@@H](NC#N)CC2=O)nc1Cl |
| InChI | InChI=1S/C15H21ClN4OS/c1-15(2,3)12-13(16)19-14(22-12)20-7-5-4-6-10(18-9-17)8-11(20)21/h10,18H,4-8H2,1-3H3/t10-/m1/s1 |
| InChIKey | IIXLDIYZXMRQJR-SNVBAGLBSA-N |
| XLogP | 3.44 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.88 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|