C11H14ClN3S — CID 106595131
4-chloro-2-(cycloheptylamino)-1,3-thiazole-5-carbonitrile (PubChem CID 106595131) has the molecular formula C11H14ClN3S and a molecular weight of 255.77 g/mol. Its IUPAC name is 4-chloro-2-(cycloheptylamino)-1,3-thiazole-5-carbonitrile.
| Compound Name | 4-chloro-2-(cycloheptylamino)-1,3-thiazole-5-carbonitrile |
|---|---|
| PubChem CID | 106595131 |
| Molecular Formula | C11H14ClN3S |
| Molecular Weight | 255.77 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 4-chloro-2-(cycloheptylamino)-1,3-thiazole-5-carbonitrile |
| SMILES | N#Cc1sc(NC2CCCCCC2)nc1Cl |
| InChI | InChI=1S/C11H14ClN3S/c12-10-9(7-13)16-11(15-10)14-8-5-3-1-2-4-6-8/h8H,1-6H2,(H,14,15) |
| InChIKey | DHEPDENIHMBENN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.77 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |