C9H10ClN3S2 — CID 106595854
4-chloro-2-(thian-4-ylamino)-1,3-thiazole-5-carbonitrile (PubChem CID 106595854) has the molecular formula C9H10ClN3S2 and a molecular weight of 259.79 g/mol. Its IUPAC name is 4-chloro-2-(thian-4-ylamino)-1,3-thiazole-5-carbonitrile.
| Compound Name | 4-chloro-2-(thian-4-ylamino)-1,3-thiazole-5-carbonitrile |
|---|---|
| PubChem CID | 106595854 |
| Molecular Formula | C9H10ClN3S2 |
| Molecular Weight | 259.79 g/mol |
| Exact Mass | 259.00 |
| IUPAC Name | 4-chloro-2-(thian-4-ylamino)-1,3-thiazole-5-carbonitrile |
| SMILES | N#Cc1sc(NC2CCSCC2)nc1Cl |
| InChI | InChI=1S/C9H10ClN3S2/c10-8-7(5-11)15-9(13-8)12-6-1-3-14-4-2-6/h6H,1-4H2,(H,12,13) |
| InChIKey | ZFDRQIZCYUGZIR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.79 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |