C11H13ClN4S — CID 71561272
3-chloro-N-cyclohexyl-[1,3]thiazolo[4,5-c]pyridazin-6-amine (PubChem CID 71561272) has the molecular formula C11H13ClN4S and a molecular weight of 268.77 g/mol. Its IUPAC name is 3-chloro-N-cyclohexyl-[1,3]thiazolo[4,5-c]pyridazin-6-amine.
| Compound Name | 3-chloro-N-cyclohexyl-[1,3]thiazolo[4,5-c]pyridazin-6-amine |
|---|---|
| PubChem CID | 71561272 |
| Molecular Formula | C11H13ClN4S |
| Molecular Weight | 268.77 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 3-chloro-N-cyclohexyl-[1,3]thiazolo[4,5-c]pyridazin-6-amine |
| SMILES | Clc1cc2sc(NC3CCCCC3)nc2nn1 |
| InChI | InChI=1S/C11H13ClN4S/c12-9-6-8-10(16-15-9)14-11(17-8)13-7-4-2-1-3-5-7/h6-7H,1-5H2,(H,13,14,16) |
| InChIKey | OVRQYAIYVMWUCA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.77 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |