C8H6Cl2N2O2S — CID 168689942
4-chloro-2-(4-chloro-2-oxopyrrolidin-1-yl)-1,3-thiazole-5-carbaldehyde (PubChem CID 168689942) has the molecular formula C8H6Cl2N2O2S and a molecular weight of 265.12 g/mol. Its IUPAC name is 4-chloro-2-(4-chloro-2-oxopyrrolidin-1-yl)-1,3-thiazole-5-carbaldehyde.
| Compound Name | 4-chloro-2-(4-chloro-2-oxopyrrolidin-1-yl)-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 168689942 |
| Molecular Formula | C8H6Cl2N2O2S |
| Molecular Weight | 265.12 g/mol |
| Exact Mass | 263.95 |
| IUPAC Name | 4-chloro-2-(4-chloro-2-oxopyrrolidin-1-yl)-1,3-thiazole-5-carbaldehyde |
| SMILES | O=Cc1sc(N2CC(Cl)CC2=O)nc1Cl |
| InChI | InChI=1S/C8H6Cl2N2O2S/c9-4-1-6(14)12(2-4)8-11-7(10)5(3-13)15-8/h3-4H,1-2H2 |
| InChIKey | HIOSRKFBRBUKFN-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.12 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|