C14H20Cl2O2 — CID 167110393
(2R,5S)-5-(3,4-dichlorophenyl)-3,3-dimethylhexane-1,2-diol (PubChem CID 167110393) has the molecular formula C14H20Cl2O2 and a molecular weight of 291.22 g/mol. Its IUPAC name is (2R,5S)-5-(3,4-dichlorophenyl)-3,3-dimethylhexane-1,2-diol.
| Compound Name | (2R,5S)-5-(3,4-dichlorophenyl)-3,3-dimethylhexane-1,2-diol |
|---|---|
| PubChem CID | 167110393 |
| Molecular Formula | C14H20Cl2O2 |
| Molecular Weight | 291.22 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | (2R,5S)-5-(3,4-dichlorophenyl)-3,3-dimethylhexane-1,2-diol |
| SMILES | C[C@@H](CC(C)(C)[C@@H](O)CO)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H20Cl2O2/c1-9(7-14(2,3)13(18)8-17)10-4-5-11(15)12(16)6-10/h4-6,9,13,17-18H,7-8H2,1-3H3/t9-,13-/m0/s1 |
| InChIKey | IXCQRDHTUIXEIC-ZANVPECISA-N |
| XLogP | 3.87 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.22 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |