C32H30FNO6 — CID 167111122
benzyl 3-[[5-(4-ethoxycarbonylphenyl)-4-fluoro-2-methoxybenzoyl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 167111122) has the molecular formula C32H30FNO6 and a molecular weight of 543.59 g/mol. Its IUPAC name is benzyl 3-[[5-(4-ethoxycarbonylphenyl)-4-fluoro-2-methoxybenzoyl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | benzyl 3-[[5-(4-ethoxycarbonylphenyl)-4-fluoro-2-methoxybenzoyl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 167111122 |
| Molecular Formula | C32H30FNO6 |
| Molecular Weight | 543.59 g/mol |
| Exact Mass | 543.21 |
| IUPAC Name | benzyl 3-[[5-(4-ethoxycarbonylphenyl)-4-fluoro-2-methoxybenzoyl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(-c2cc(C(=O)NC3C4C=CC(C4)C3C(=O)OCc3ccccc3)c(OC)cc2F)cc1 |
| InChI | InChI=1S/C32H30FNO6/c1-3-39-31(36)21-11-9-20(10-12-21)24-16-25(27(38-2)17-26(24)33)30(35)34-29-23-14-13-22(15-23)28(29)32(37)40-18-19-7-5-4-6-8-19/h4-14,16-17,22-23,28-29H,3,15,18H2,1-2H3,(H,34,35) |
| InChIKey | DBYIZLUNCRDRLQ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.59 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|