C21H28N2O4 — CID 167111423
tert-butyl N-[(3S,5R)-5-[(1S)-1-ethenyl-3,4-dihydro-1H-isoquinoline-2-carbonyl]oxolan-3-yl]carbamate (PubChem CID 167111423) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is tert-butyl N-[(3S,5R)-5-[(1S)-1-ethenyl-3,4-dihydro-1H-isoquinoline-2-carbonyl]oxolan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,5R)-5-[(1S)-1-ethenyl-3,4-dihydro-1H-isoquinoline-2-carbonyl]oxolan-3-yl]carbamate |
|---|---|
| PubChem CID | 167111423 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | tert-butyl N-[(3S,5R)-5-[(1S)-1-ethenyl-3,4-dihydro-1H-isoquinoline-2-carbonyl]oxolan-3-yl]carbamate |
| SMILES | C=C[C@H]1c2ccccc2CCN1C(=O)[C@H]1C[C@H](NC(=O)OC(C)(C)C)CO1 |
| InChI | InChI=1S/C21H28N2O4/c1-5-17-16-9-7-6-8-14(16)10-11-23(17)19(24)18-12-15(13-26-18)22-20(25)27-21(2,3)4/h5-9,15,17-18H,1,10-13H2,2-4H3,(H,22,25)/t15-,17-,18+/m0/s1 |
| InChIKey | MWHDRQOZEIUYAI-RYQLBKOJSA-N |
| XLogP | 2.98 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|