C19H23N5O3 — CID 167111667
N-[(3R,6R)-4-azido-6-[(1S)-1-ethenyl-3,4-dihydro-1H-isoquinoline-2-carbonyl]oxan-3-yl]acetamide (PubChem CID 167111667) has the molecular formula C19H23N5O3 and a molecular weight of 369.43 g/mol. Its IUPAC name is N-[(3R,6R)-4-azido-6-[(1S)-1-ethenyl-3,4-dihydro-1H-isoquinoline-2-carbonyl]oxan-3-yl]acetamide.
| Compound Name | N-[(3R,6R)-4-azido-6-[(1S)-1-ethenyl-3,4-dihydro-1H-isoquinoline-2-carbonyl]oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 167111667 |
| Molecular Formula | C19H23N5O3 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | N-[(3R,6R)-4-azido-6-[(1S)-1-ethenyl-3,4-dihydro-1H-isoquinoline-2-carbonyl]oxan-3-yl]acetamide |
| SMILES | C=C[C@H]1c2ccccc2CCN1C(=O)[C@H]1CC(N=[N+]=[N-])[C@@H](NC(C)=O)CO1 |
| InChI | InChI=1S/C19H23N5O3/c1-3-17-14-7-5-4-6-13(14)8-9-24(17)19(26)18-10-15(22-23-20)16(11-27-18)21-12(2)25/h3-7,15-18H,1,8-11H2,2H3,(H,21,25)/t15?,16-,17-,18+/m0/s1 |
| InChIKey | YHFUBZRRJJOPRQ-XFYFCPPXSA-N |
| XLogP | 2.27 |
| TPSA | 107.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|