C21H22FN5O2 — CID 169221350
[(2R,4S,5S)-5-amino-4-azidooxan-2-yl]-[(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanone (PubChem CID 169221350) has the molecular formula C21H22FN5O2 and a molecular weight of 395.44 g/mol. Its IUPAC name is [(2R,4S,5S)-5-amino-4-azidooxan-2-yl]-[(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanone.
| Compound Name | [(2R,4S,5S)-5-amino-4-azidooxan-2-yl]-[(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanone |
|---|---|
| PubChem CID | 169221350 |
| Molecular Formula | C21H22FN5O2 |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | [(2R,4S,5S)-5-amino-4-azidooxan-2-yl]-[(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanone |
| SMILES | [N-]=[N+]=N[C@H]1C[C@H](C(=O)N2CCc3ccccc3[C@@H]2c2ccc(F)cc2)OC[C@H]1N |
| InChI | InChI=1S/C21H22FN5O2/c22-15-7-5-14(6-8-15)20-16-4-2-1-3-13(16)9-10-27(20)21(28)19-11-18(25-26-24)17(23)12-29-19/h1-8,17-20H,9-12,23H2/t17-,18+,19-,20+/m1/s1 |
| InChIKey | BXZPXZJNAGXOKT-WCIQWLHISA-N |
| XLogP | 3.09 |
| TPSA | 104.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|