C24H29FN4O3Si — CID 174012375
[(2S)-4-azido-5-trimethylsilyloxyoxan-2-yl]-[(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanone (PubChem CID 174012375) has the molecular formula C24H29FN4O3Si and a molecular weight of 468.61 g/mol. Its IUPAC name is [(2S)-4-azido-5-trimethylsilyloxyoxan-2-yl]-[(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanone.
| Compound Name | [(2S)-4-azido-5-trimethylsilyloxyoxan-2-yl]-[(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanone |
|---|---|
| PubChem CID | 174012375 |
| Molecular Formula | C24H29FN4O3Si |
| Molecular Weight | 468.61 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | [(2S)-4-azido-5-trimethylsilyloxyoxan-2-yl]-[(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanone |
| SMILES | C[Si](C)(C)OC1CO[C@H](C(=O)N2CCc3ccccc3[C@@H]2c2ccc(F)cc2)CC1N=[N+]=[N-] |
| InChI | InChI=1S/C24H29FN4O3Si/c1-33(2,3)32-22-15-31-21(14-20(22)27-28-26)24(30)29-13-12-16-6-4-5-7-19(16)23(29)17-8-10-18(25)11-9-17/h4-11,20-23H,12-15H2,1-3H3/t20?,21-,22?,23-/m0/s1 |
| InChIKey | JSZAFASHXGNKRE-ZWDXQAFOSA-N |
| XLogP | 4.99 |
| TPSA | 87.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.61 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|