C22H20F4N4O5S — CID 170451577
[4-azido-6-[(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]oxan-3-yl] trifluoromethanesulfonate (PubChem CID 170451577) has the molecular formula C22H20F4N4O5S and a molecular weight of 528.48 g/mol. Its IUPAC name is [4-azido-6-[(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]oxan-3-yl] trifluoromethanesulfonate.
| Compound Name | [4-azido-6-[(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]oxan-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 170451577 |
| Molecular Formula | C22H20F4N4O5S |
| Molecular Weight | 528.48 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | [4-azido-6-[(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]oxan-3-yl] trifluoromethanesulfonate |
| SMILES | [N-]=[N+]=NC1CC(C(=O)N2CCc3ccccc3[C@@H]2c2ccc(F)cc2)OCC1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C22H20F4N4O5S/c23-15-7-5-14(6-8-15)20-16-4-2-1-3-13(16)9-10-30(20)21(31)18-11-17(28-29-27)19(12-34-18)35-36(32,33)22(24,25)26/h1-8,17-20H,9-12H2/t17?,18?,19?,20-/m0/s1 |
| InChIKey | XWNARGJOSJTNAE-WSXZXBBNSA-N |
| XLogP | 4.00 |
| TPSA | 121.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|